C17H24N2O — CID 101400822
(3S,5R,7S)-7-benzyl-5-but-3-enyl-3-methyl-1,4-diazepan-2-one (PubChem CID 101400822) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (3S,5R,7S)-7-benzyl-5-but-3-enyl-3-methyl-1,4-diazepan-2-one.
| Compound Name | (3S,5R,7S)-7-benzyl-5-but-3-enyl-3-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 101400822 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (3S,5R,7S)-7-benzyl-5-but-3-enyl-3-methyl-1,4-diazepan-2-one |
| SMILES | C=CCC[C@@H]1C[C@H](Cc2ccccc2)NC(=O)[C@H](C)N1 |
| InChI | InChI=1S/C17H24N2O/c1-3-4-10-15-12-16(19-17(20)13(2)18-15)11-14-8-6-5-7-9-14/h3,5-9,13,15-16,18H,1,4,10-12H2,2H3,(H,19,20)/t13-,15+,16-/m0/s1 |
| InChIKey | AKNOYOCJVXBAAK-IMJJTQAJSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|