C27H37N3O2 — CID 102035409
(3S,5R,7S)-3-(4-aminobutyl)-7-benzyl-5-but-3-enyl-1-[(4-hydroxyphenyl)methyl]-1,4-diazepan-2-one (PubChem CID 102035409) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is (3S,5R,7S)-3-(4-aminobutyl)-7-benzyl-5-but-3-enyl-1-[(4-hydroxyphenyl)methyl]-1,4-diazepan-2-one.
| Compound Name | (3S,5R,7S)-3-(4-aminobutyl)-7-benzyl-5-but-3-enyl-1-[(4-hydroxyphenyl)methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102035409 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | (3S,5R,7S)-3-(4-aminobutyl)-7-benzyl-5-but-3-enyl-1-[(4-hydroxyphenyl)methyl]-1,4-diazepan-2-one |
| SMILES | C=CCC[C@@H]1C[C@H](Cc2ccccc2)N(Cc2ccc(O)cc2)C(=O)[C@H](CCCCN)N1 |
| InChI | InChI=1S/C27H37N3O2/c1-2-3-11-23-19-24(18-21-9-5-4-6-10-21)30(20-22-13-15-25(31)16-14-22)27(32)26(29-23)12-7-8-17-28/h2,4-6,9-10,13-16,23-24,26,29,31H,1,3,7-8,11-12,17-20,28H2/t23-,24+,26+/m1/s1 |
| InChIKey | ADCZRFHSNXLEEC-USZFVNFHSA-N |
| XLogP | 4.16 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|