C18H36O4Si — CID 101404352
5-[5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-one (PubChem CID 101404352) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is 5-[5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-one.
| Compound Name | 5-[5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-one |
|---|---|
| PubChem CID | 101404352 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 5-[5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pentan-2-one |
| SMILES | CC(=O)CCCC1OC(C)(C)OC1C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-13(19)11-10-12-15-16(21-18(6,7)20-15)14(2)22-23(8,9)17(3,4)5/h14-16H,10-12H2,1-9H3 |
| InChIKey | SCRLCKOUOZBGFO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|