C19H29B2ClO5 — CID 101409619
2-[(4-chlorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101409619) has the molecular formula C19H29B2ClO5 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(4-chlorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101409619 |
| Molecular Formula | C19H29B2ClO5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[(4-chlorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(OC(B2OC(C)(C)C(C)(C)O2)c2ccc(Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C19H29B2ClO5/c1-16(2)17(3,4)25-20(24-16)15(13-9-11-14(22)12-10-13)23-21-26-18(5,6)19(7,8)27-21/h9-12,15H,1-8H3 |
| InChIKey | XHAXZOXTIZKBRC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|