C39H36Na2O8S2 — CID 101410438
disodium;4-[4-[2-phenyl-9-[4-(4-sulfonatobutoxy)phenyl]fluoren-9-yl]phenoxy]butane-1-sulfonate (PubChem CID 101410438) has the molecular formula C39H36Na2O8S2 and a molecular weight of 742.82 g/mol. Its IUPAC name is disodium;4-[4-[2-phenyl-9-[4-(4-sulfonatobutoxy)phenyl]fluoren-9-yl]phenoxy]butane-1-sulfonate.
| Compound Name | disodium;4-[4-[2-phenyl-9-[4-(4-sulfonatobutoxy)phenyl]fluoren-9-yl]phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 101410438 |
| Molecular Formula | C39H36Na2O8S2 |
| Molecular Weight | 742.82 g/mol |
| Exact Mass | 742.16 |
| IUPAC Name | disodium;4-[4-[2-phenyl-9-[4-(4-sulfonatobutoxy)phenyl]fluoren-9-yl]phenoxy]butane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCOc1ccc(C2(c3ccc(OCCCCS(=O)(=O)[O-])cc3)c3ccccc3-c3ccc(-c4ccccc4)cc32)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C39H38O8S2.2Na/c40-48(41,42)26-8-6-24-46-33-19-15-31(16-20-33)39(32-17-21-34(22-18-32)47-25-7-9-27-49(43,44)45)37-13-5-4-12-35(37)36-23-14-30(28-38(36)39)29-10-2-1-3-11-29;;/h1-5,10-23,28H,6-9,24-27H2,(H,40,41,42)(H,43,44,45);;/q;2*+1/p-2 |
| InChIKey | YPRZSBFLDNKHQC-UHFFFAOYSA-L |
| XLogP | 1.13 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.82 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|