C30H43F3O9 — CID 101415249
diethyl (2R,6S)-2-[(2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyethyl]-6-methyloctanedioate (PubChem CID 101415249) has the molecular formula C30H43F3O9 and a molecular weight of 604.66 g/mol. Its IUPAC name is diethyl (2R,6S)-2-[(2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyethyl]-6-methyloctanedioate.
| Compound Name | diethyl (2R,6S)-2-[(2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyethyl]-6-methyloctanedioate |
|---|---|
| PubChem CID | 101415249 |
| Molecular Formula | C30H43F3O9 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | diethyl (2R,6S)-2-[(2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyethyl]-6-methyloctanedioate |
| SMILES | CCOC(=O)C[C@@H](C)CCC[C@H](C[C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)[C@H]1COC(C)(C)O1)C(=O)OCC |
| InChI | InChI=1S/C30H43F3O9/c1-7-38-25(34)17-20(3)13-12-14-21(26(35)39-8-2)18-23(24-19-40-28(4,5)42-24)41-27(36)29(37-6,30(31,32)33)22-15-10-9-11-16-22/h9-11,15-16,20-21,23-24H,7-8,12-14,17-19H2,1-6H3/t20-,21+,23-,24+,29-/m0/s1 |
| InChIKey | RIWAXNCZHCLPKF-IOQGESJDSA-N |
| XLogP | 5.48 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|