C25H36O3 — CID 101416121
ethyl (E,5R)-5-phenylmethoxyhexadec-2-en-6-ynoate (PubChem CID 101416121) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is ethyl (E,5R)-5-phenylmethoxyhexadec-2-en-6-ynoate.
| Compound Name | ethyl (E,5R)-5-phenylmethoxyhexadec-2-en-6-ynoate |
|---|---|
| PubChem CID | 101416121 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | ethyl (E,5R)-5-phenylmethoxyhexadec-2-en-6-ynoate |
| SMILES | CCCCCCCCCC#C[C@@H](C/C=C/C(=O)OCC)OCc1ccccc1 |
| InChI | InChI=1S/C25H36O3/c1-3-5-6-7-8-9-10-11-15-19-24(20-16-21-25(26)27-4-2)28-22-23-17-13-12-14-18-23/h12-14,16-18,21,24H,3-11,20,22H2,1-2H3/b21-16+/t24-/m0/s1 |
| InChIKey | IICPXSLWTKBEGV-VGBYGFDOSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|