C29H36INO2Si — CID 101417676
1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[2-(2-iodophenyl)ethyl-methylamino]-2-phenylethanone (PubChem CID 101417676) has the molecular formula C29H36INO2Si and a molecular weight of 585.60 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[2-(2-iodophenyl)ethyl-methylamino]-2-phenylethanone.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[2-(2-iodophenyl)ethyl-methylamino]-2-phenylethanone |
|---|---|
| PubChem CID | 101417676 |
| Molecular Formula | C29H36INO2Si |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[2-(2-iodophenyl)ethyl-methylamino]-2-phenylethanone |
| SMILES | CN(CCc1ccccc1I)C(C(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H36INO2Si/c1-29(2,3)34(5,6)33-25-18-16-24(17-19-25)28(32)27(23-13-8-7-9-14-23)31(4)21-20-22-12-10-11-15-26(22)30/h7-19,27H,20-21H2,1-6H3 |
| InChIKey | SZBLZAWRXSBENL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|