C18H24F2O9 — CID 101424470
[(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(1,1-difluorobut-3-enyl)oxan-2-yl]methyl acetate (PubChem CID 101424470) has the molecular formula C18H24F2O9 and a molecular weight of 422.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(1,1-difluorobut-3-enyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(1,1-difluorobut-3-enyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101424470 |
| Molecular Formula | C18H24F2O9 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(1,1-difluorobut-3-enyl)oxan-2-yl]methyl acetate |
| SMILES | C=CCC(F)(F)[C@H]1[C@@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H24F2O9/c1-6-7-18(19,20)14-16(27-11(4)23)15(26-10(3)22)13(8-25-9(2)21)29-17(14)28-12(5)24/h6,13-17H,1,7-8H2,2-5H3/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | QXQKTXYYCULOCY-HHARLNAUSA-N |
| XLogP | 1.53 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|