C20H22O4 — CID 101426354
1-adamantyl (2S)-2-hydroxy-3-oxo-1H-indene-2-carboxylate (PubChem CID 101426354) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-adamantyl (2S)-2-hydroxy-3-oxo-1H-indene-2-carboxylate.
| Compound Name | 1-adamantyl (2S)-2-hydroxy-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 101426354 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-adamantyl (2S)-2-hydroxy-3-oxo-1H-indene-2-carboxylate |
| SMILES | O=C(OC12CC3CC(CC(C3)C1)C2)[C@]1(O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C20H22O4/c21-17-16-4-2-1-3-15(16)11-20(17,23)18(22)24-19-8-12-5-13(9-19)7-14(6-12)10-19/h1-4,12-14,23H,5-11H2/t12?,13?,14?,19?,20-/m0/s1 |
| InChIKey | NTJZJNWRULUISG-SYPJPGIQSA-N |
| XLogP | 2.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|