About 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate
1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate (PubChem CID 78093484) has the molecular formula C21H24O5
and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate.
Molecular Properties
| Compound Name | 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate |
| PubChem CID | 78093484 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate |
| SMILES | COc1cccc2c1CC(O)(C(=O)OC13CC4CC(CC(C4)C1)C3)C2=O |
| InChI | InChI=1S/C21H24O5/c1-25-17-4-2-3-15-16(17)11-21(24,18(15)22)19(23)26-20-8-12-5-13(9-20)7-14(6-12)10-20/h2-4,12-14,24H,5-11H2,1H3 |
| InChIKey | VDSVKFUZEJQWQO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate?
The IUPAC name of 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate (CID 78093484) is 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate.
What is the SMILES notation for 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate?
The canonical SMILES for 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate is COc1cccc2c1CC(O)(C(=O)OC13CC4CC(CC(C4)C1)C3)C2=O.
What is the InChIKey of 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate?
The InChIKey is VDSVKFUZEJQWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O5/c1-25-17-4-2-3-15-16(17)11-21(24,18(15)22)19(23)26-20-8-12-5-13(9-20)7-14(6-12)10-20/h2-4,12-14,24H,5-11H2,1H3.
What are the key properties of 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate?
1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate has a molecular weight of 356.42 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl 2-hydroxy-7-methoxy-3-oxo-1H-indene-2-carboxylate is sourced from PubChem (CID 78093484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).