C19H22N2O2 — CID 101427546
(2R,4R,5S,8S)-5-methyl-4-phenyl-8-propan-2-yl-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),10-dien-7-one (PubChem CID 101427546) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2R,4R,5S,8S)-5-methyl-4-phenyl-8-propan-2-yl-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),10-dien-7-one.
| Compound Name | (2R,4R,5S,8S)-5-methyl-4-phenyl-8-propan-2-yl-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),10-dien-7-one |
|---|---|
| PubChem CID | 101427546 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2R,4R,5S,8S)-5-methyl-4-phenyl-8-propan-2-yl-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),10-dien-7-one |
| SMILES | CC(C)[C@H]1C(=O)N2[C@H](O[C@H](c3ccccc3)[C@@H]2C)c2cccn21 |
| InChI | InChI=1S/C19H22N2O2/c1-12(2)16-18(22)21-13(3)17(14-8-5-4-6-9-14)23-19(21)15-10-7-11-20(15)16/h4-13,16-17,19H,1-3H3/t13-,16-,17-,19+/m0/s1 |
| InChIKey | HNAYNJZNERRNIT-LZLXCTOHSA-N |
| XLogP | 3.69 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |