C19H23F3N2O6S — CID 101433395
[(4R,4aR,9aS)-4-methoxy-2-oxo-9-(trifluoromethylsulfonyl)-1,3,4,9a-tetrahydrocarbazol-4a-yl] N,N-diethylcarbamate (PubChem CID 101433395) has the molecular formula C19H23F3N2O6S and a molecular weight of 464.46 g/mol. Its IUPAC name is [(4R,4aR,9aS)-4-methoxy-2-oxo-9-(trifluoromethylsulfonyl)-1,3,4,9a-tetrahydrocarbazol-4a-yl] N,N-diethylcarbamate.
| Compound Name | [(4R,4aR,9aS)-4-methoxy-2-oxo-9-(trifluoromethylsulfonyl)-1,3,4,9a-tetrahydrocarbazol-4a-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 101433395 |
| Molecular Formula | C19H23F3N2O6S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [(4R,4aR,9aS)-4-methoxy-2-oxo-9-(trifluoromethylsulfonyl)-1,3,4,9a-tetrahydrocarbazol-4a-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@]12c3ccccc3N(S(=O)(=O)C(F)(F)F)[C@H]1CC(=O)C[C@H]2OC |
| InChI | InChI=1S/C19H23F3N2O6S/c1-4-23(5-2)17(26)30-18-13-8-6-7-9-14(13)24(31(27,28)19(20,21)22)15(18)10-12(25)11-16(18)29-3/h6-9,15-16H,4-5,10-11H2,1-3H3/t15-,16+,18+/m0/s1 |
| InChIKey | XAIPHBHXCRYHDE-LZLYRXPVSA-N |
| XLogP | 2.78 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |