C12H17NO2 — CID 101434688
(1S,6S,7S)-7-isocyanato-5,5,7-trimethylbicyclo[4.2.0]octan-2-one (PubChem CID 101434688) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (1S,6S,7S)-7-isocyanato-5,5,7-trimethylbicyclo[4.2.0]octan-2-one.
| Compound Name | (1S,6S,7S)-7-isocyanato-5,5,7-trimethylbicyclo[4.2.0]octan-2-one |
|---|---|
| PubChem CID | 101434688 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (1S,6S,7S)-7-isocyanato-5,5,7-trimethylbicyclo[4.2.0]octan-2-one |
| SMILES | CC1(C)CCC(=O)[C@H]2C[C@](C)(N=C=O)[C@@H]21 |
| InChI | InChI=1S/C12H17NO2/c1-11(2)5-4-9(15)8-6-12(3,10(8)11)13-7-14/h8,10H,4-6H2,1-3H3/t8-,10+,12+/m1/s1 |
| InChIKey | IVZFKCYKYGHXRV-QRTLGDNMSA-N |
| XLogP | 2.11 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|