C13H17N3O3 — CID 175869934
1,5-diisocyanato-2-(isocyanatomethyl)-1,3,3-trimethylcyclohexane (PubChem CID 175869934) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1,5-diisocyanato-2-(isocyanatomethyl)-1,3,3-trimethylcyclohexane.
| Compound Name | 1,5-diisocyanato-2-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 175869934 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1,5-diisocyanato-2-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| SMILES | CC1(C)CC(N=C=O)CC(C)(N=C=O)C1CN=C=O |
| InChI | InChI=1S/C13H17N3O3/c1-12(2)4-10(15-8-18)5-13(3,16-9-19)11(12)6-14-7-17/h10-11H,4-6H2,1-3H3 |
| InChIKey | RAYCMOUYVVOAQR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|