C9H12N2O2 — CID 12670803
2-isocyanato-4-(isocyanatomethyl)-1,1-dimethylcyclobutane (PubChem CID 12670803) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-isocyanato-4-(isocyanatomethyl)-1,1-dimethylcyclobutane.
| Compound Name | 2-isocyanato-4-(isocyanatomethyl)-1,1-dimethylcyclobutane |
|---|---|
| PubChem CID | 12670803 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-isocyanato-4-(isocyanatomethyl)-1,1-dimethylcyclobutane |
| SMILES | CC1(C)C(CN=C=O)CC1N=C=O |
| InChI | InChI=1S/C9H12N2O2/c1-9(2)7(4-10-5-12)3-8(9)11-6-13/h7-8H,3-4H2,1-2H3 |
| InChIKey | GITNWUQZQXZLRG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|