C13H23NO — CID 175020162
3-isocyanato-1,1,2,2,5,5-hexamethylcyclohexane (PubChem CID 175020162) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-isocyanato-1,1,2,2,5,5-hexamethylcyclohexane.
| Compound Name | 3-isocyanato-1,1,2,2,5,5-hexamethylcyclohexane |
|---|---|
| PubChem CID | 175020162 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-isocyanato-1,1,2,2,5,5-hexamethylcyclohexane |
| SMILES | CC1(C)CC(N=C=O)C(C)(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H23NO/c1-11(2)7-10(14-9-15)13(5,6)12(3,4)8-11/h10H,7-8H2,1-6H3 |
| InChIKey | IWKOOAZXYDBREL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|