C12H18IN3O2 — CID 149490808
imino-[[5-isocyanato-3-(isocyanatomethyl)-1,3-dimethylcyclohexyl]methyl]-λ3-iodane (PubChem CID 149490808) has the molecular formula C12H18IN3O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is imino-[[5-isocyanato-3-(isocyanatomethyl)-1,3-dimethylcyclohexyl]methyl]-λ3-iodane.
| Compound Name | imino-[[5-isocyanato-3-(isocyanatomethyl)-1,3-dimethylcyclohexyl]methyl]-λ3-iodane |
|---|---|
| PubChem CID | 149490808 |
| Molecular Formula | C12H18IN3O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | imino-[[5-isocyanato-3-(isocyanatomethyl)-1,3-dimethylcyclohexyl]methyl]-λ3-iodane |
| SMILES | [H]/N=I/CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C12H18IN3O2/c1-11(6-13-14)3-10(16-9-18)4-12(2,5-11)7-15-8-17/h10,14H,3-7H2,1-2H3 |
| InChIKey | ZFAYLWGWJDMJJZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|