C36H40N2O9 — CID 101434834
[(2S,3S,4S,5R,6R)-3-acetyloxy-2-[acetyl(pyrrolidine-1-carbonyl)amino]-5-hydroxy-6-(trityloxymethyl)oxan-4-yl] acetate (PubChem CID 101434834) has the molecular formula C36H40N2O9 and a molecular weight of 644.72 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-3-acetyloxy-2-[acetyl(pyrrolidine-1-carbonyl)amino]-5-hydroxy-6-(trityloxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-3-acetyloxy-2-[acetyl(pyrrolidine-1-carbonyl)amino]-5-hydroxy-6-(trityloxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 101434834 |
| Molecular Formula | C36H40N2O9 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-3-acetyloxy-2-[acetyl(pyrrolidine-1-carbonyl)amino]-5-hydroxy-6-(trityloxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H](N(C(C)=O)C(=O)N2CCCC2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C36H40N2O9/c1-24(39)38(35(43)37-21-13-14-22-37)34-33(46-26(3)41)32(45-25(2)40)31(42)30(47-34)23-44-36(27-15-7-4-8-16-27,28-17-9-5-10-18-28)29-19-11-6-12-20-29/h4-12,15-20,30-34,42H,13-14,21-23H2,1-3H3/t30-,31-,32+,33+,34+/m1/s1 |
| InChIKey | JNHMVFXIWOSKDC-ZOHVZMGWSA-N |
| XLogP | 4.01 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|