C19H27NO2 — CID 101438001
2-[(1E,3E,5E,7Z)-3,7-dimethyl-8-nitroocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 101438001) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7Z)-3,7-dimethyl-8-nitroocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7Z)-3,7-dimethyl-8-nitroocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 101438001 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-[(1E,3E,5E,7Z)-3,7-dimethyl-8-nitroocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C\[N+](=O)[O-])C(C)(C)CCC1 |
| InChI | InChI=1S/C19H27NO2/c1-15(8-6-9-16(2)14-20(21)22)11-12-18-17(3)10-7-13-19(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3/b9-6+,12-11+,15-8+,16-14- |
| InChIKey | UUEMERVQDQZQRQ-XFYACQKRSA-N |
| XLogP | 5.75 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|