C20H28N2O5+2 — CID 101446696
5,23-dimethyl-8,11,14,17,20-pentaoxa-5,23-diazoniatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene (PubChem CID 101446696) has the molecular formula C20H28N2O5+2 and a molecular weight of 376.45 g/mol. Its IUPAC name is 5,23-dimethyl-8,11,14,17,20-pentaoxa-5,23-diazoniatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene.
| Compound Name | 5,23-dimethyl-8,11,14,17,20-pentaoxa-5,23-diazoniatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene |
|---|---|
| PubChem CID | 101446696 |
| Molecular Formula | C20H28N2O5+2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5,23-dimethyl-8,11,14,17,20-pentaoxa-5,23-diazoniatricyclo[19.4.0.02,7]pentacosa-1(21),2(7),3,5,22,24-hexaene |
| SMILES | C[n+]1ccc2c(c1)OCCOCCOCCOCCOc1c[n+](C)ccc1-2 |
| InChI | InChI=1S/C20H28N2O5/c1-21-5-3-17-18-4-6-22(2)16-20(18)27-14-12-25-10-8-23-7-9-24-11-13-26-19(17)15-21/h3-6,15-16H,7-14H2,1-2H3/q+2 |
| InChIKey | UBOLJMHUPRYZNO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 53.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|