C16H22O3 — CID 101446720
(1S,2S,5R,6S,9R,10R)-9-methoxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridec-3-en-13-one (PubChem CID 101446720) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1S,2S,5R,6S,9R,10R)-9-methoxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridec-3-en-13-one.
| Compound Name | (1S,2S,5R,6S,9R,10R)-9-methoxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridec-3-en-13-one |
|---|---|
| PubChem CID | 101446720 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1S,2S,5R,6S,9R,10R)-9-methoxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridec-3-en-13-one |
| SMILES | CO[C@@]12OC[C@@]3(C)[C@H]4C=C[C@H](C)[C@]4(CC[C@@]13C)C2=O |
| InChI | InChI=1S/C16H22O3/c1-10-5-6-11-13(2)9-19-16(18-4)12(17)15(10,11)8-7-14(13,16)3/h5-6,10-11H,7-9H2,1-4H3/t10-,11+,13-,14+,15-,16-/m0/s1 |
| InChIKey | GAPHUIFKDJHVLQ-BMYJUKNCSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|