C11H9Cl4N4OP3 — CID 101449571
4,4,6,6-tetrachlorospiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2'-3,4-dihydrobenzo[h][1,3,2]benzoxazaphosphinine] (PubChem CID 101449571) has the molecular formula C11H9Cl4N4OP3 and a molecular weight of 447.95 g/mol. Its IUPAC name is 4,4,6,6-tetrachlorospiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2'-3,4-dihydrobenzo[h][1,3,2]benzoxazaphosphinine].
| Compound Name | 4,4,6,6-tetrachlorospiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2'-3,4-dihydrobenzo[h][1,3,2]benzoxazaphosphinine] |
|---|---|
| PubChem CID | 101449571 |
| Molecular Formula | C11H9Cl4N4OP3 |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 445.87 |
| IUPAC Name | 4,4,6,6-tetrachlorospiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2'-3,4-dihydrobenzo[h][1,3,2]benzoxazaphosphinine] |
| SMILES | ClP1(Cl)=NP(Cl)(Cl)=NP2(=N1)NCc1ccc3ccccc3c1O2 |
| InChI | InChI=1S/C11H9Cl4N4OP3/c12-21(13)17-22(14,15)19-23(18-21)16-7-9-6-5-8-3-1-2-4-10(8)11(9)20-23/h1-6,16H,7H2 |
| InChIKey | JTUFXIQLRRUCDK-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|