C11H9NS — CID 150002534
2,3-dihydrobenzo[g][1,2]benzothiazole (PubChem CID 150002534) has the molecular formula C11H9NS and a molecular weight of 187.27 g/mol. Its IUPAC name is 2,3-dihydrobenzo[g][1,2]benzothiazole.
| Compound Name | 2,3-dihydrobenzo[g][1,2]benzothiazole |
|---|---|
| PubChem CID | 150002534 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2,3-dihydrobenzo[g][1,2]benzothiazole |
| SMILES | c1ccc2c3c(ccc2c1)CNS3 |
| InChI | InChI=1S/C11H9NS/c1-2-4-10-8(3-1)5-6-9-7-12-13-11(9)10/h1-6,12H,7H2 |
| InChIKey | DBPGRFYENFGVAA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|