C12H9NS2 — CID 3005004
4H-benzo[h][1,4]benzothiazine-3-thione (PubChem CID 3005004) has the molecular formula C12H9NS2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4H-benzo[h][1,4]benzothiazine-3-thione.
| Compound Name | 4H-benzo[h][1,4]benzothiazine-3-thione |
|---|---|
| PubChem CID | 3005004 |
| Molecular Formula | C12H9NS2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 4H-benzo[h][1,4]benzothiazine-3-thione |
| SMILES | S=C1CSc2c(ccc3ccccc23)N1 |
| InChI | InChI=1S/C12H9NS2/c14-11-7-15-12-9-4-2-1-3-8(9)5-6-10(12)13-11/h1-6H,7H2,(H,13,14) |
| InChIKey | QRKULOHBEXBATE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|