About benzo[g][1,3]benzodithiole;ethane
benzo[g][1,3]benzodithiole;ethane (PubChem CID 54233828) has the molecular formula C15H20S2
and a molecular weight of 264.46 g/mol. Its IUPAC name is benzo[g][1,3]benzodithiole;ethane.
Molecular Properties
| Compound Name | benzo[g][1,3]benzodithiole;ethane |
| PubChem CID | 54233828 |
| Molecular Formula | C15H20S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | benzo[g][1,3]benzodithiole;ethane |
| SMILES | CC.CC.c1ccc2c3c(ccc2c1)SCS3 |
| InChI | InChI=1S/C11H8S2.2C2H6/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10;2*1-2/h1-6H,7H2;2*1-2H3 |
| InChIKey | QLDFNQFFKMAFIF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[g][1,3]benzodithiole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g][1,3]benzodithiole;ethane?
The IUPAC name of benzo[g][1,3]benzodithiole;ethane (CID 54233828) is benzo[g][1,3]benzodithiole;ethane.
What is the SMILES notation for benzo[g][1,3]benzodithiole;ethane?
The canonical SMILES for benzo[g][1,3]benzodithiole;ethane is CC.CC.c1ccc2c3c(ccc2c1)SCS3.
What is the InChIKey of benzo[g][1,3]benzodithiole;ethane?
The InChIKey is QLDFNQFFKMAFIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8S2.2C2H6/c1-2-4-9-8(3-1)5-6-10-11(9)13-7-12-10;2*1-2/h1-6H,7H2;2*1-2H3.
What are the key properties of benzo[g][1,3]benzodithiole;ethane?
benzo[g][1,3]benzodithiole;ethane has a molecular weight of 264.46 g/mol, XLogP of 6.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g][1,3]benzodithiole;ethane is sourced from PubChem (CID 54233828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).