C42H28Cl2N3O4P3 — CID 177479537
CID 177479537 (PubChem CID 177479537) has the molecular formula C42H28Cl2N3O4P3 and a molecular weight of 802.53 g/mol.
| Compound Name | CID 177479537 |
|---|---|
| PubChem CID | 177479537 |
| Molecular Formula | C42H28Cl2N3O4P3 |
| Molecular Weight | 802.53 g/mol |
| Exact Mass | 801.07 |
| IUPAC Name | — |
| SMILES | ClP1(Cl)=NP2(=NP3(=N1)Oc1ccc4ccccc4c1Cc1c(ccc4ccccc14)O3)Oc1ccc3ccccc3c1Cc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C42H28Cl2N3O4P3/c43-52(44)45-53(48-39-21-17-27-9-1-5-13-31(27)35(39)25-36-32-14-6-2-10-28(32)18-22-40(36)49-53)47-54(46-52)50-41-23-19-29-11-3-7-15-33(29)37(41)26-38-34-16-8-4-12-30(34)20-24-42(38)51-54/h1-24H,25-26H2 |
| InChIKey | SJTRPDAVCUMVCV-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 74.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.53 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|