C33H24O2P2Se3 — CID 46242237
14,16-diphenyl-14,16-bis(selanylidene)-13,17-dioxa-15-selena-14λ5,16λ5-diphosphapentacyclo[16.8.0.03,12.04,9.021,26]hexacosa-1(18),3(12),4,6,8,10,19,21,23,25-decaene (PubChem CID 46242237) has the molecular formula C33H24O2P2Se3 and a molecular weight of 751.38 g/mol. Its IUPAC name is 14,16-diphenyl-14,16-bis(selanylidene)-13,17-dioxa-15-selena-14λ5,16λ5-diphosphapentacyclo[16.8.0.03,12.04,9.021,26]hexacosa-1(18),3(12),4,6,8,10,19,21,23,25-decaene.
| Compound Name | 14,16-diphenyl-14,16-bis(selanylidene)-13,17-dioxa-15-selena-14λ5,16λ5-diphosphapentacyclo[16.8.0.03,12.04,9.021,26]hexacosa-1(18),3(12),4,6,8,10,19,21,23,25-decaene |
|---|---|
| PubChem CID | 46242237 |
| Molecular Formula | C33H24O2P2Se3 |
| Molecular Weight | 751.38 g/mol |
| Exact Mass | 753.87 |
| IUPAC Name | 14,16-diphenyl-14,16-bis(selanylidene)-13,17-dioxa-15-selena-14λ5,16λ5-diphosphapentacyclo[16.8.0.03,12.04,9.021,26]hexacosa-1(18),3(12),4,6,8,10,19,21,23,25-decaene |
| SMILES | [Se]=P1(c2ccccc2)Oc2ccc3ccccc3c2Cc2c(ccc3ccccc23)OP(=[Se])(c2ccccc2)[Se]1 |
| InChI | InChI=1S/C33H24O2P2Se3/c38-36(26-13-3-1-4-14-26)34-32-21-19-24-11-7-9-17-28(24)30(32)23-31-29-18-10-8-12-25(29)20-22-33(31)35-37(39,40-36)27-15-5-2-6-16-27/h1-22H,23H2 |
| InChIKey | PJKKFEAPLMBLGG-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.38 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|