C9H12O — CID 101457545
2,3,5,6-tetradeuterio-4-(1,1-dideuteriopropyl)phenol (PubChem CID 101457545) has the molecular formula C9H12O and a molecular weight of 142.23 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(1,1-dideuteriopropyl)phenol.
| Compound Name | 2,3,5,6-tetradeuterio-4-(1,1-dideuteriopropyl)phenol |
|---|---|
| PubChem CID | 101457545 |
| Molecular Formula | C9H12O |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.13 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(1,1-dideuteriopropyl)phenol |
| SMILES | [2H]c1c([2H])c(C([2H])([2H])CC)c([2H])c([2H])c1O |
| InChI | InChI=1S/C9H12O/c1-2-3-8-4-6-9(10)7-5-8/h4-7,10H,2-3H2,1H3/i3D2,4D,5D,6D,7D |
| InChIKey | KLSLBUSXWBJMEC-LPDCXOHVSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |