C10H14O — CID 90471106
1-butyl-2,3,5,6-tetradeuterio-4-deuteriooxybenzene (PubChem CID 90471106) has the molecular formula C10H14O and a molecular weight of 155.25 g/mol. Its IUPAC name is 1-butyl-2,3,5,6-tetradeuterio-4-deuteriooxybenzene.
| Compound Name | 1-butyl-2,3,5,6-tetradeuterio-4-deuteriooxybenzene |
|---|---|
| PubChem CID | 90471106 |
| Molecular Formula | C10H14O |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-butyl-2,3,5,6-tetradeuterio-4-deuteriooxybenzene |
| SMILES | [2H]Oc1c([2H])c([2H])c(CCCC)c([2H])c1[2H] |
| InChI | InChI=1S/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3/i5D,6D,7D,8D/hD |
| InChIKey | CYYZDBDROVLTJU-QBYFNKCPSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |