C26H20O2 — CID 101467024
1-[(1S,2R,3S)-2-benzoyl-3-phenyl-1-(2-phenylethynyl)cyclopropyl]ethanone (PubChem CID 101467024) has the molecular formula C26H20O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-[(1S,2R,3S)-2-benzoyl-3-phenyl-1-(2-phenylethynyl)cyclopropyl]ethanone.
| Compound Name | 1-[(1S,2R,3S)-2-benzoyl-3-phenyl-1-(2-phenylethynyl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 101467024 |
| Molecular Formula | C26H20O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[(1S,2R,3S)-2-benzoyl-3-phenyl-1-(2-phenylethynyl)cyclopropyl]ethanone |
| SMILES | CC(=O)[C@]1(C#Cc2ccccc2)[C@H](C(=O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H20O2/c1-19(27)26(18-17-20-11-5-2-6-12-20)23(21-13-7-3-8-14-21)24(26)25(28)22-15-9-4-10-16-22/h2-16,23-24H,1H3/t23-,24+,26+/m1/s1 |
| InChIKey | HQPINJLVIWHHQP-USZFVNFHSA-N |
| XLogP | 4.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|