C26H24N2O3P- — CID 101467297
4-(4-diethoxyphosphorylphenyl)-2-phenyl-6-pyridin-2-ylpyridine (PubChem CID 101467297) has the molecular formula C26H24N2O3P- and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-(4-diethoxyphosphorylphenyl)-2-phenyl-6-pyridin-2-ylpyridine.
| Compound Name | 4-(4-diethoxyphosphorylphenyl)-2-phenyl-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 101467297 |
| Molecular Formula | C26H24N2O3P- |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-(4-diethoxyphosphorylphenyl)-2-phenyl-6-pyridin-2-ylpyridine |
| SMILES | CCOP(=O)(OCC)c1ccc(-c2cc(-c3[c-]cccc3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C26H24N2O3P/c1-3-30-32(29,31-4-2)23-15-13-20(14-16-23)22-18-25(21-10-6-5-7-11-21)28-26(19-22)24-12-8-9-17-27-24/h5-10,12-19H,3-4H2,1-2H3/q-1 |
| InChIKey | KEUZASRCFKESKF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|