C14H18O6 — CID 101470289
diethyl 4-methyl-5-propanoylfuran-2,3-dicarboxylate (PubChem CID 101470289) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is diethyl 4-methyl-5-propanoylfuran-2,3-dicarboxylate.
| Compound Name | diethyl 4-methyl-5-propanoylfuran-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101470289 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | diethyl 4-methyl-5-propanoylfuran-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1oc(C(=O)CC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C14H18O6/c1-5-9(15)11-8(4)10(13(16)18-6-2)12(20-11)14(17)19-7-3/h5-7H2,1-4H3 |
| InChIKey | IAAYGQMBFIRXCE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |