C36H44Br2N2O5 — CID 10147035
[2,7-dibromo-6-(diethylamino)-9-(2-hexoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium acetate (PubChem CID 10147035) has the molecular formula C36H44Br2N2O5 and a molecular weight of 744.56 g/mol. Its IUPAC name is [2,7-dibromo-6-(diethylamino)-9-(2-hexoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium acetate.
| Compound Name | [2,7-dibromo-6-(diethylamino)-9-(2-hexoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium acetate |
|---|---|
| PubChem CID | 10147035 |
| Molecular Formula | C36H44Br2N2O5 |
| Molecular Weight | 744.56 g/mol |
| Exact Mass | 742.16 |
| IUPAC Name | [2,7-dibromo-6-(diethylamino)-9-(2-hexoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium acetate |
| SMILES | CC(=O)[O-].CCCCCCOC(=O)c1ccccc1-c1c2cc(Br)c(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)c(Br)cc12 |
| InChI | InChI=1S/C34H41Br2N2O3.C2H4O2/c1-6-11-12-15-18-40-34(39)24-17-14-13-16-23(24)33-25-19-27(35)29(37(7-2)8-3)21-31(25)41-32-22-30(38(9-4)10-5)28(36)20-26(32)33;1-2(3)4/h13-14,16-17,19-22H,6-12,15,18H2,1-5H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | QYZMQEMDZIQWKO-UHFFFAOYSA-M |
| XLogP | 7.88 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.56 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|