About 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+)
2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) (PubChem CID 101472538) has the molecular formula C13H20O4Ti
and a molecular weight of 288.17 g/mol. Its IUPAC name is 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+).
Molecular Properties
| Compound Name | 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) |
| PubChem CID | 101472538 |
| Molecular Formula | C13H20O4Ti |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) |
| SMILES | CC(C)[O-].CC(C)[O-].[O-]Cc1ccccc1[O-].[Ti+4] |
| InChI | InChI=1S/C7H7O2.2C3H7O.Ti/c8-5-6-3-1-2-4-7(6)9;2*1-3(2)4;/h1-4,9H,5H2;2*3H,1-2H3;/q3*-1;+4/p-1 |
| InChIKey | PMLJZYQVKNNHOV-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+)?
The IUPAC name of 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) (CID 101472538) is 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+).
What is the SMILES notation for 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+)?
The canonical SMILES for 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) is CC(C)[O-].CC(C)[O-].[O-]Cc1ccccc1[O-].[Ti+4].
What is the InChIKey of 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+)?
The InChIKey is PMLJZYQVKNNHOV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7O2.2C3H7O.Ti/c8-5-6-3-1-2-4-7(6)9;2*1-3(2)4;/h1-4,9H,5H2;2*3H,1-2H3;/q3*-1;+4/p-1.
What are the key properties of 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+)?
2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) has a molecular weight of 288.17 g/mol, XLogP of -0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxidomethyl)phenolate;bis(propan-2-olate);titanium(4+) is sourced from PubChem (CID 101472538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).