C39H41N7O8 — CID 101472955
tert-butyl 2-[8-[[(2-ethoxy-2-oxoethyl)-(9H-fluoren-9-ylmethoxycarbonylamino)amino]methyl]-6-(phenylmethoxycarbonylamino)purin-9-yl]acetate (PubChem CID 101472955) has the molecular formula C39H41N7O8 and a molecular weight of 735.80 g/mol. Its IUPAC name is tert-butyl 2-[8-[[(2-ethoxy-2-oxoethyl)-(9H-fluoren-9-ylmethoxycarbonylamino)amino]methyl]-6-(phenylmethoxycarbonylamino)purin-9-yl]acetate.
| Compound Name | tert-butyl 2-[8-[[(2-ethoxy-2-oxoethyl)-(9H-fluoren-9-ylmethoxycarbonylamino)amino]methyl]-6-(phenylmethoxycarbonylamino)purin-9-yl]acetate |
|---|---|
| PubChem CID | 101472955 |
| Molecular Formula | C39H41N7O8 |
| Molecular Weight | 735.80 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | tert-butyl 2-[8-[[(2-ethoxy-2-oxoethyl)-(9H-fluoren-9-ylmethoxycarbonylamino)amino]methyl]-6-(phenylmethoxycarbonylamino)purin-9-yl]acetate |
| SMILES | CCOC(=O)CN(Cc1nc2c(NC(=O)OCc3ccccc3)ncnc2n1CC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H41N7O8/c1-5-51-32(47)20-45(44-38(50)53-23-30-28-17-11-9-15-26(28)27-16-10-12-18-29(27)30)19-31-42-34-35(43-37(49)52-22-25-13-7-6-8-14-25)40-24-41-36(34)46(31)21-33(48)54-39(2,3)4/h6-18,24,30H,5,19-23H2,1-4H3,(H,44,50)(H,40,41,43,49) |
| InChIKey | MKWLBEAGPVXZNI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 176.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|