C16H10F6N2O2 — CID 101473222
2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)-1,7-phenanthrolin-6-yl]ethane-1,1-diol (PubChem CID 101473222) has the molecular formula C16H10F6N2O2 and a molecular weight of 376.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)-1,7-phenanthrolin-6-yl]ethane-1,1-diol.
| Compound Name | 2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)-1,7-phenanthrolin-6-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 101473222 |
| Molecular Formula | C16H10F6N2O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)-1,7-phenanthrolin-6-yl]ethane-1,1-diol |
| SMILES | Cc1cc(C(F)(F)F)c2cc(C(O)(O)C(F)(F)F)c3ncccc3c2n1 |
| InChI | InChI=1S/C16H10F6N2O2/c1-7-5-10(15(17,18)19)9-6-11(14(25,26)16(20,21)22)13-8(12(9)24-7)3-2-4-23-13/h2-6,25-26H,1H3 |
| InChIKey | XBHCXMXPGMDNND-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|