C15H9ClF3N3 — CID 169259644
5-chloro-8-[6-methyl-5-(trifluoromethyl)-2-pyridinyl]-1,6-naphthyridine (PubChem CID 169259644) has the molecular formula C15H9ClF3N3 and a molecular weight of 323.71 g/mol. Its IUPAC name is 5-chloro-8-[6-methyl-5-(trifluoromethyl)-2-pyridinyl]-1,6-naphthyridine.
| Compound Name | 5-chloro-8-[6-methyl-5-(trifluoromethyl)-2-pyridinyl]-1,6-naphthyridine |
|---|---|
| PubChem CID | 169259644 |
| Molecular Formula | C15H9ClF3N3 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 5-chloro-8-[6-methyl-5-(trifluoromethyl)-2-pyridinyl]-1,6-naphthyridine |
| SMILES | Cc1nc(-c2cnc(Cl)c3cccnc23)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H9ClF3N3/c1-8-11(15(17,18)19)4-5-12(22-8)10-7-21-14(16)9-3-2-6-20-13(9)10/h2-7H,1H3 |
| InChIKey | IEBLNKOROGUUIP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|