C17H15F6N3O2 — CID 15890649
1-[2-tert-butyl-3-(trifluoromethyl)pyrazolo[4,3-h]quinolin-5-yl]-2,2,2-trifluoroethane-1,1-diol (PubChem CID 15890649) has the molecular formula C17H15F6N3O2 and a molecular weight of 407.31 g/mol. Its IUPAC name is 1-[2-tert-butyl-3-(trifluoromethyl)pyrazolo[4,3-h]quinolin-5-yl]-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-[2-tert-butyl-3-(trifluoromethyl)pyrazolo[4,3-h]quinolin-5-yl]-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 15890649 |
| Molecular Formula | C17H15F6N3O2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[2-tert-butyl-3-(trifluoromethyl)pyrazolo[4,3-h]quinolin-5-yl]-2,2,2-trifluoroethane-1,1-diol |
| SMILES | CC(C)(C)n1nc2c(cc(C(O)(O)C(F)(F)F)c3cccnc32)c1C(F)(F)F |
| InChI | InChI=1S/C17H15F6N3O2/c1-14(2,3)26-13(16(18,19)20)9-7-10(15(27,28)17(21,22)23)8-5-4-6-24-11(8)12(9)25-26/h4-7,27-28H,1-3H3 |
| InChIKey | LOXDAQRBRRBOMU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|