C26H42N2O6 — CID 101480458
(4S,8S)-4,8-bis[(1S,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]-1,5-diazocane-2,6-dione (PubChem CID 101480458) has the molecular formula C26H42N2O6 and a molecular weight of 478.63 g/mol. Its IUPAC name is (4S,8S)-4,8-bis[(1S,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]-1,5-diazocane-2,6-dione.
| Compound Name | (4S,8S)-4,8-bis[(1S,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]-1,5-diazocane-2,6-dione |
|---|---|
| PubChem CID | 101480458 |
| Molecular Formula | C26H42N2O6 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | (4S,8S)-4,8-bis[(1S,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]-1,5-diazocane-2,6-dione |
| SMILES | CC1([C@@H]2C[C@H]([C@@H]3CC(=O)N[C@H]([C@H]4C[C@@H](C5(C)OCCO5)C4(C)C)CC(=O)N3)C2(C)C)OCCO1 |
| InChI | InChI=1S/C26H42N2O6/c1-23(2)15(11-19(23)25(5)31-7-8-32-25)17-13-21(29)28-18(14-22(30)27-17)16-12-20(24(16,3)4)26(6)33-9-10-34-26/h15-20H,7-14H2,1-6H3,(H,27,30)(H,28,29)/t15-,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | CBMNHMXRMHPFPG-XRNRSJMDSA-N |
| XLogP | 2.60 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |