C16H23NO2 — CID 101488296
O-[(2S)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]hydroxylamine (PubChem CID 101488296) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is O-[(2S)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]hydroxylamine.
| Compound Name | O-[(2S)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 101488296 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | O-[(2S)-3,6-dimethyl-1-phenylmethoxyhepta-3,4-dien-2-yl]hydroxylamine |
| SMILES | CC(=C=CC(C)C)[C@@H](COCc1ccccc1)ON |
| InChI | InChI=1S/C16H23NO2/c1-13(2)9-10-14(3)16(19-17)12-18-11-15-7-5-4-6-8-15/h4-9,13,16H,11-12,17H2,1-3H3/t10?,16-/m1/s1 |
| InChIKey | ZVQJYUJGTCSVRX-YRQZNCJOSA-N |
| XLogP | 3.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|