C22H44O4 — CID 101489265
[(2S,3S,4R,6R)-1-hydroxy-2,4,6-trimethyloctan-3-yl] (2S,3S,4R,6R)-3-hydroxy-2,4,6-trimethyloctanoate (PubChem CID 101489265) has the molecular formula C22H44O4 and a molecular weight of 372.59 g/mol. Its IUPAC name is [(2S,3S,4R,6R)-1-hydroxy-2,4,6-trimethyloctan-3-yl] (2S,3S,4R,6R)-3-hydroxy-2,4,6-trimethyloctanoate.
| Compound Name | [(2S,3S,4R,6R)-1-hydroxy-2,4,6-trimethyloctan-3-yl] (2S,3S,4R,6R)-3-hydroxy-2,4,6-trimethyloctanoate |
|---|---|
| PubChem CID | 101489265 |
| Molecular Formula | C22H44O4 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | [(2S,3S,4R,6R)-1-hydroxy-2,4,6-trimethyloctan-3-yl] (2S,3S,4R,6R)-3-hydroxy-2,4,6-trimethyloctanoate |
| SMILES | CC[C@@H](C)C[C@@H](C)[C@H](O)[C@H](C)C(=O)O[C@@H]([C@H](C)C[C@H](C)CC)[C@@H](C)CO |
| InChI | InChI=1S/C22H44O4/c1-9-14(3)11-16(5)20(24)19(8)22(25)26-21(18(7)13-23)17(6)12-15(4)10-2/h14-21,23-24H,9-13H2,1-8H3/t14-,15-,16-,17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | OYJPUHHHKCIERV-JRINFJIASA-N |
| XLogP | 4.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |