C12H19N — CID 101497236
1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-b]isoquinoline (PubChem CID 101497236) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-b]isoquinoline.
| Compound Name | 1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-b]isoquinoline |
|---|---|
| PubChem CID | 101497236 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1,2,3,5,6,7,8,9,10,10a-decahydropyrrolo[1,2-b]isoquinoline |
| SMILES | C1CCC2=C(C1)CC1CCCN1C2 |
| InChI | InChI=1S/C12H19N/c1-2-5-11-9-13-7-3-6-12(13)8-10(11)4-1/h12H,1-9H2 |
| InChIKey | YVIGTVNUFGLAKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|