C10H17N — CID 175973770
6-propan-2-ylidene-1,2,3,5,7,8-hexahydropyrrolizine (PubChem CID 175973770) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 6-propan-2-ylidene-1,2,3,5,7,8-hexahydropyrrolizine.
| Compound Name | 6-propan-2-ylidene-1,2,3,5,7,8-hexahydropyrrolizine |
|---|---|
| PubChem CID | 175973770 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 6-propan-2-ylidene-1,2,3,5,7,8-hexahydropyrrolizine |
| SMILES | CC(C)=C1CC2CCCN2C1 |
| InChI | InChI=1S/C10H17N/c1-8(2)9-6-10-4-3-5-11(10)7-9/h10H,3-7H2,1-2H3 |
| InChIKey | GOYHEUZINSJBSI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|