C23H27N3O4 — CID 10158429
4-heptyl-N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)phenyl]benzamide (PubChem CID 10158429) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-heptyl-N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)phenyl]benzamide.
| Compound Name | 4-heptyl-N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 10158429 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-heptyl-N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)phenyl]benzamide |
| SMILES | CCCCCCCc1ccc(C(=O)Nc2ccc(-n3nc(OC)oc3=O)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-3-4-5-6-7-8-17-9-11-18(12-10-17)21(27)24-19-13-15-20(16-14-19)26-23(28)30-22(25-26)29-2/h9-16H,3-8H2,1-2H3,(H,24,27) |
| InChIKey | FSFMLTOJLQJLRX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|