C28H30Cl2N4O6 — CID 10175289
3-(3,5-dichlorophenyl)-3-[[3-phenylmethoxy-2-[3-(pyridin-2-ylamino)propoxycarbonylamino]propanoyl]amino]propanoic acid (PubChem CID 10175289) has the molecular formula C28H30Cl2N4O6 and a molecular weight of 589.48 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-[[3-phenylmethoxy-2-[3-(pyridin-2-ylamino)propoxycarbonylamino]propanoyl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-[[3-phenylmethoxy-2-[3-(pyridin-2-ylamino)propoxycarbonylamino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10175289 |
| Molecular Formula | C28H30Cl2N4O6 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-[[3-phenylmethoxy-2-[3-(pyridin-2-ylamino)propoxycarbonylamino]propanoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C(COCc1ccccc1)NC(=O)OCCCNc1ccccn1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C28H30Cl2N4O6/c29-21-13-20(14-22(30)15-21)23(16-26(35)36)33-27(37)24(18-39-17-19-7-2-1-3-8-19)34-28(38)40-12-6-11-32-25-9-4-5-10-31-25/h1-5,7-10,13-15,23-24H,6,11-12,16-18H2,(H,31,32)(H,33,37)(H,34,38)(H,35,36) |
| InChIKey | LRCPJZMEYIOFPZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|