C10H9NOS — CID 10176483
3-benzyl-1,2-thiazol-4-ol (PubChem CID 10176483) has the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. Its IUPAC name is 3-benzyl-1,2-thiazol-4-ol.
| Compound Name | 3-benzyl-1,2-thiazol-4-ol |
|---|---|
| PubChem CID | 10176483 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 3-benzyl-1,2-thiazol-4-ol |
| SMILES | Oc1csnc1Cc1ccccc1 |
| InChI | InChI=1S/C10H9NOS/c12-10-7-13-11-9(10)6-8-4-2-1-3-5-8/h1-5,7,12H,6H2 |
| InChIKey | VKKRNNVVUVHJAN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |