C26H34N2O4 — CID 10181641
3-[4-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-2,6-dimethoxyphenoxy]-N,N-dipropylpropan-1-amine (PubChem CID 10181641) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[4-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-2,6-dimethoxyphenoxy]-N,N-dipropylpropan-1-amine.
| Compound Name | 3-[4-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-2,6-dimethoxyphenoxy]-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 10181641 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 3-[4-[(E)-2-(1,3-benzoxazol-2-yl)ethenyl]-2,6-dimethoxyphenoxy]-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCOc1c(OC)cc(/C=C/c2nc3ccccc3o2)cc1OC |
| InChI | InChI=1S/C26H34N2O4/c1-5-14-28(15-6-2)16-9-17-31-26-23(29-3)18-20(19-24(26)30-4)12-13-25-27-21-10-7-8-11-22(21)32-25/h7-8,10-13,18-19H,5-6,9,14-17H2,1-4H3/b13-12+ |
| InChIKey | ZAIAIJSWYZXNCO-OUKQBFOZSA-N |
| XLogP | 5.91 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|