C14H15NO5 — CID 102006203
(E)-3-(5,6,7-trimethoxy-1H-indol-2-yl)prop-2-enoic acid (PubChem CID 102006203) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (E)-3-(5,6,7-trimethoxy-1H-indol-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(5,6,7-trimethoxy-1H-indol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 102006203 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (E)-3-(5,6,7-trimethoxy-1H-indol-2-yl)prop-2-enoic acid |
| SMILES | COc1cc2cc(/C=C/C(=O)O)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C14H15NO5/c1-18-10-7-8-6-9(4-5-11(16)17)15-12(8)14(20-3)13(10)19-2/h4-7,15H,1-3H3,(H,16,17)/b5-4+ |
| InChIKey | RQELHGSQOVRVBL-SNAWJCMRSA-N |
| XLogP | 2.29 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|