C13H18N2O6 — CID 102008196
diethyl 1-(2-hydroxyethylamino)-4-oxopyridine-3,5-dicarboxylate (PubChem CID 102008196) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is diethyl 1-(2-hydroxyethylamino)-4-oxopyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-(2-hydroxyethylamino)-4-oxopyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 102008196 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | diethyl 1-(2-hydroxyethylamino)-4-oxopyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cn(NCCO)cc(C(=O)OCC)c1=O |
| InChI | InChI=1S/C13H18N2O6/c1-3-20-12(18)9-7-15(14-5-6-16)8-10(11(9)17)13(19)21-4-2/h7-8,14,16H,3-6H2,1-2H3 |
| InChIKey | GCYICQVGFOQIQS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |